cas: 1131-40-4 — see every product listed under this CAS number, including other names
1-Bromo-2,4,6-trimethoxybenzene, 95% (CAS 1131-40-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F008951-1G |
| cas | 1131-40-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 294.71 Pln | |
| Fluorochem | 10g | 440.49 Pln | |
| Fluorochem | 25g | 529.00 Pln | |
| Fluorochem | 100g | 1945.17 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-bromo-1,3,5-trimethoxybenzene (CAS 1131-40-4) is a chemical compound with the molecular formula C9H11BrO3 and a molecular weight of 247.09 g/mol. IUPAC name: 2-bromo-1,3,5-trimethoxybenzene. InChIKey: BPWYNWSOQOXOPI-UHFFFAOYSA-N.
| Molecular formula | C9H11BrO3 |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | 2-bromo-1,3,5-trimethoxybenzene |
| InChIKey | BPWYNWSOQOXOPI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)Br)OC |
Computed by PubChem (NCBI)