cas: 1131-40-4 — see every product listed under this CAS number, including other names
2-Bromo-1,3,5-trimethoxybenzene, >98.0%(GC) (CAS 1131-40-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B6448-1G |
| cas | 1131-40-4 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 123.26 Pln | |
| TCI | 5g | 280.61 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
2-bromo-1,3,5-trimethoxybenzene (CAS 1131-40-4) is a chemical compound with the molecular formula C9H11BrO3 and a molecular weight of 247.09 g/mol. IUPAC name: 2-bromo-1,3,5-trimethoxybenzene. InChIKey: BPWYNWSOQOXOPI-UHFFFAOYSA-N.
| Molecular formula | C9H11BrO3 |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | 2-bromo-1,3,5-trimethoxybenzene |
| InChIKey | BPWYNWSOQOXOPI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)Br)OC |
Computed by PubChem (NCBI)