cas: 1355246-92-2 — see every product listed under this CAS number, including other names
1-Bromo-2,4-dichloro-3,5-difluorobenzene, 97%, 97% (CAS 1355246-92-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117YUU-100mg |
| cas | 1355246-92-2 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 304.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-bromo-2,4-dichloro-3,5-difluorobenzene (CAS 1355246-92-2) is a chemical compound with the molecular formula C6HBrCl2F2 and a molecular weight of 261.88 g/mol. IUPAC name: 1-bromo-2,4-dichloro-3,5-difluorobenzene. InChIKey: JMZSSKGAWNYCOL-UHFFFAOYSA-N.
| Molecular formula | C6HBrCl2F2 |
|---|---|
| Molecular weight | 261.88 g/mol |
| IUPAC name | 1-bromo-2,4-dichloro-3,5-difluorobenzene |
| InChIKey | JMZSSKGAWNYCOL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Cl)F)Cl)F |
Computed by PubChem (NCBI)