CAS 1437779-97-9 is the registry number for 1-bromo-3,5-dichloro-2,4-difluorobenzene. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-3,5-dichloro-2,4-difluorobenzene (CAS 1437779-97-9) is a chemical compound with the molecular formula C6HBrCl2F2 and a molecular weight of 261.88 g/mol. IUPAC name: 1-bromo-3,5-dichloro-2,4-difluorobenzene. InChIKey: NQMWRJNMTQAXDS-UHFFFAOYSA-N.
| Molecular formula | C6HBrCl2F2 |
|---|---|
| Molecular weight | 261.88 g/mol |
| IUPAC name | 1-bromo-3,5-dichloro-2,4-difluorobenzene |
| InChIKey | NQMWRJNMTQAXDS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)Cl)F)Cl |
Computed by PubChem (NCBI)