cas: 122375-83-1 — see every product listed under this CAS number, including other names
1-Bromo-2-chloro-3,4,5-trifluorobenzene (CAS 122375-83-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F035653-1G |
| cas | 122375-83-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2325.24 Pln | |
| Fluorochem | 5g | 6844.48 Pln |
| delivery time | 3-4 weeks |
|---|
1-bromo-2-chloro-3,4,5-trifluorobenzene (CAS 122375-83-1) is a chemical compound with the molecular formula C6HBrClF3 and a molecular weight of 245.42 g/mol. IUPAC name: 1-bromo-2-chloro-3,4,5-trifluorobenzene. InChIKey: QVKOVRVAPIYNAL-UHFFFAOYSA-N.
| Molecular formula | C6HBrClF3 |
|---|---|
| Molecular weight | 245.42 g/mol |
| IUPAC name | 1-bromo-2-chloro-3,4,5-trifluorobenzene |
| InChIKey | QVKOVRVAPIYNAL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Cl)F)F)F |
Computed by PubChem (NCBI)