CAS 122375-83-1 is the registry number for 1-Bromo-2-chloro-3,4,5-trifluorobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-bromo-2-chloro-3,4,5-trifluorobenzene (CAS 122375-83-1) is a chemical compound with the molecular formula C6HBrClF3 and a molecular weight of 245.42 g/mol. IUPAC name: 1-bromo-2-chloro-3,4,5-trifluorobenzene. InChIKey: QVKOVRVAPIYNAL-UHFFFAOYSA-N.
| Molecular formula | C6HBrClF3 |
|---|---|
| Molecular weight | 245.42 g/mol |
| IUPAC name | 1-bromo-2-chloro-3,4,5-trifluorobenzene |
| InChIKey | QVKOVRVAPIYNAL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Cl)F)F)F |
Computed by PubChem (NCBI)