cas: 1352317-80-6 — see every product listed under this CAS number, including other names
1-Bromo-2-fluoro-4-methoxy-3-nitrobenzene, 98%, 98% (CAS 1352317-80-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118LHV-50mg |
| cas | 1352317-80-6 |
| size | 50mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 160.40 Pln | |
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 318.80 Pln | |
| Chemat | 1g | 549.20 Pln | |
| Chemat | 5g | 1384.40 Pln | |
| Chemat | 10g | 2507.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-2-fluoro-4-methoxy-3-nitrobenzene (CAS 1352317-80-6) is a chemical compound with the molecular formula C7H5BrFNO3 and a molecular weight of 250.02 g/mol. IUPAC name: 1-bromo-2-fluoro-4-methoxy-3-nitrobenzene. InChIKey: LJJAOMRFFXQENV-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO3 |
|---|---|
| Molecular weight | 250.02 g/mol |
| IUPAC name | 1-bromo-2-fluoro-4-methoxy-3-nitrobenzene |
| InChIKey | LJJAOMRFFXQENV-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Br)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)