1-Bromo-2-fluoro-4-nitrobenzene, 98%, 98%
cas: 185331-69-5 — see every product listed under this CAS number, including other names
1-Bromo-2-fluoro-4-nitrobenzene, 98%, 98% (CAS 185331-69-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143PE-1g |
| cas | 185331-69-5 |
| size | 1g |
| availability | 1698g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 102.80 Pln | |
| Chemat | 25g | 155.60 Pln | |
| Chemat | 100g | 424.40 Pln | |
| Chemat | 500g | 1886.40 Pln | |
| Chemat | 1kg | 3510.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-2-fluoro-4-nitrobenzene (CAS 185331-69-5) is a chemical compound with the molecular formula C6H3BrFNO2 and a molecular weight of 220.00 g/mol. IUPAC name: 1-bromo-2-fluoro-4-nitrobenzene. InChIKey: AZYQMHQOHNGPRR-UHFFFAOYSA-N.
| Molecular formula | C6H3BrFNO2 |
|---|---|
| Molecular weight | 220.00 g/mol |
| IUPAC name | 1-bromo-2-fluoro-4-nitrobenzene |
| InChIKey | AZYQMHQOHNGPRR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])F)Br |
Computed by PubChem (NCBI)