Products 1807209-95-5

CAS 1807209-95-5 is the registry number for 4-Bromo-3-fluoropicolinic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-bromo-3-fluoropyridine-2-carboxylic acid (CAS 1807209-95-5) is a chemical compound with the molecular formula C6H3BrFNO2 and a molecular weight of 220.00 g/mol. IUPAC name: 4-bromo-3-fluoropyridine-2-carboxylic acid. InChIKey: WCXXREYONUJTTL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3BrFNO2
Molecular weight220.00 g/mol
IUPAC name4-bromo-3-fluoropyridine-2-carboxylic acid
InChIKeyWCXXREYONUJTTL-UHFFFAOYSA-N
SMILESC1=CN=C(C(=C1Br)F)C(=O)O

Computed by PubChem (NCBI)