cas: 1698019-89-4 — see every product listed under this CAS number, including other names
1-Bromo-2-oxo-6,9,12,15,18,21,24,27-octaoxa-3-azatriacontan-30-oic acid, 95%, 95% (CAS 1698019-89-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HZCE-100mg |
| cas | 1698019-89-4 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 323.60 Pln | |
| Chemat | 250mg | 563.60 Pln | |
| Chemat | 1g | 1413.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-[2-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1698019-89-4) is a chemical compound with the molecular formula C21H40BrNO11 and a molecular weight of 562.4 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: KLVSMPBQYRYTMJ-UHFFFAOYSA-N.
| Molecular formula | C21H40BrNO11 |
|---|---|
| Molecular weight | 562.4 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | KLVSMPBQYRYTMJ-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CBr)C(=O)O |
Computed by PubChem (NCBI)