cas: 1698019-89-4 — see every product listed under this CAS number, including other names
Bromoacetamido-PEG8-acid 95% (CAS 1698019-89-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A755514-100mg |
| cas | 1698019-89-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 375.94 Pln | |
| Ambeed | 250mg | 654.06 Pln | |
| Ambeed | 1g | 1644.19 Pln | |
| Ambeed | 5g | 5632.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A755514 |
3-[2-[2-[2-[2-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1698019-89-4) is a chemical compound with the molecular formula C21H40BrNO11 and a molecular weight of 562.4 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: KLVSMPBQYRYTMJ-UHFFFAOYSA-N.
| Molecular formula | C21H40BrNO11 |
|---|---|
| Molecular weight | 562.4 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | KLVSMPBQYRYTMJ-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CBr)C(=O)O |
Computed by PubChem (NCBI)