cas: 1807518-67-7 — see every product listed under this CAS number, including other names
1-Bromo-2-oxo-6,9,12,15-tetraoxa-3-azaoctadecan-18-oic acid, 95% (CAS 1807518-67-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F870307-100MG |
| cas | 1807518-67-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 154.13 Pln | |
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 789.32 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1807518-67-7) is a chemical compound with the molecular formula C13H24BrNO7 and a molecular weight of 386.24 g/mol. IUPAC name: 3-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: LMFYGPXSVUULRZ-UHFFFAOYSA-N.
| Molecular formula | C13H24BrNO7 |
|---|---|
| Molecular weight | 386.24 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | LMFYGPXSVUULRZ-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCNC(=O)CBr)C(=O)O |
Computed by PubChem (NCBI)