cas: 655256-70-5 — see every product listed under this CAS number, including other names
1-Bromo-3-(isocyano(tosyl)methyl)benzene 95% (CAS 655256-70-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A381556-250mg |
| cas | 655256-70-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 826.50 Pln | |
| Ambeed | 1g | 1955.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A381556 |
1-bromo-3-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene (CAS 655256-70-5) is a chemical compound with the molecular formula C15H12BrNO2S and a molecular weight of 350.2 g/mol. IUPAC name: 1-bromo-3-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene. InChIKey: DVWQTDDROHVAFJ-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO2S |
|---|---|
| Molecular weight | 350.2 g/mol |
| IUPAC name | 1-bromo-3-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene |
| InChIKey | DVWQTDDROHVAFJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C(C2=CC(=CC=C2)Br)[N+]#[C-] |
Computed by PubChem (NCBI)