CAS 936548-16-2 appears in our catalog under these names: alpha–Tosyl–(2–bromobenzyl)isocyanide, A-Tosyl-(2-bromobenzyl) isocyanide, 97%, a-Tosyl-(2-bromobenzyl) isocyanide 95%, a-Tosyl-(2-bromobenzyl) isocyanide, 95%, A-TOSYL-(2-BROMOBENZYL) ISOCYANIDE, 95%, 95%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g.
1-bromo-2-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene (CAS 936548-16-2) is a chemical compound with the molecular formula C15H12BrNO2S and a molecular weight of 350.2 g/mol. IUPAC name: 1-bromo-2-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene. InChIKey: FDHXCUCSERDBAT-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO2S |
|---|---|
| Molecular weight | 350.2 g/mol |
| IUPAC name | 1-bromo-2-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene |
| InChIKey | FDHXCUCSERDBAT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C(C2=CC=CC=C2Br)[N+]#[C-] |
Computed by PubChem (NCBI)