cas: 1214348-94-3 — see every product listed under this CAS number, including other names
1-Bromo-3-Chloro-2-(Difluoromethyl)Benzene, ≥97% (CAS 1214348-94-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12ER1K-100mg |
| cas | 1214348-94-3 |
| size | 100mg |
| availability | 10g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 707.60 Pln | |
| Chemat | 250mg | 818.00 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Chemat | 5g | 2541.20 Pln | |
| Fluorochem | 100mg | 1304.77 Pln | |
| Fluorochem | 250mg | 1513.03 Pln | |
| Fluorochem | 1g | 2028.47 Pln | |
| Fluorochem | 5g | 4704.61 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
1-bromo-3-chloro-2-(difluoromethyl)benzene (CAS 1214348-94-3) is a chemical compound with the molecular formula C7H4BrClF2 and a molecular weight of 241.46 g/mol. IUPAC name: 1-bromo-3-chloro-2-(difluoromethyl)benzene. InChIKey: MSQMEPQYYGNQPZ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClF2 |
|---|---|
| Molecular weight | 241.46 g/mol |
| IUPAC name | 1-bromo-3-chloro-2-(difluoromethyl)benzene |
| InChIKey | MSQMEPQYYGNQPZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)C(F)F)Cl |
Computed by PubChem (NCBI)