cas: 152840-71-6 — see every product listed under this CAS number, including other names
1-Bromo-3-chloro-2,4,5-trifluorobenzene, 98%, 98% (CAS 152840-71-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AS2V-100mg |
| cas | 152840-71-6 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 563.60 Pln | |
| Chemat | 25g | 2027.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-3-chloro-2,4,5-trifluorobenzene (CAS 152840-71-6) is a chemical compound with the molecular formula C6HBrClF3 and a molecular weight of 245.42 g/mol. IUPAC name: 1-bromo-3-chloro-2,4,5-trifluorobenzene. InChIKey: VYULIZVZKXJRMU-UHFFFAOYSA-N.
| Molecular formula | C6HBrClF3 |
|---|---|
| Molecular weight | 245.42 g/mol |
| IUPAC name | 1-bromo-3-chloro-2,4,5-trifluorobenzene |
| InChIKey | VYULIZVZKXJRMU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)Cl)F)F |
Computed by PubChem (NCBI)