CAS 16079-88-2 appears in our catalog under these names: 1-Bromo-3-chloro-5,5-dimethylhydantoin, 95%, 1-Bromo-3-chloro-5,5-dimethylhydantoin, 1-Bromo-3-chloro-5,5-dimethylimidazolidine-2,4-dione, 95%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 50g, 250g.
1-bromo-3-chloro-5,5-dimethylimidazolidine-2,4-dione (CAS 16079-88-2) is a chemical compound with the molecular formula C5H6BrClN2O2 and a molecular weight of 241.47 g/mol. IUPAC name: 1-bromo-3-chloro-5,5-dimethylimidazolidine-2,4-dione. InChIKey: PIEXCQIOSMOEOU-UHFFFAOYSA-N.
| Molecular formula | C5H6BrClN2O2 |
|---|---|
| Molecular weight | 241.47 g/mol |
| IUPAC name | 1-bromo-3-chloro-5,5-dimethylimidazolidine-2,4-dione |
| InChIKey | PIEXCQIOSMOEOU-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C(=O)N1Br)Cl)C |
Computed by PubChem (NCBI)