Products 2762687-33-0

CAS 2762687-33-0 is the registry number for 5-Bromo-1-methyl-1H-imidazole-2-carboxylic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-bromo-1-methylimidazole-2-carboxylic acid;hydrochloride (CAS 2762687-33-0) is a chemical compound with the molecular formula C5H6BrClN2O2 and a molecular weight of 241.47 g/mol. IUPAC name: 5-bromo-1-methylimidazole-2-carboxylic acid;hydrochloride. InChIKey: ZXPSCQZCUHUELV-UHFFFAOYSA-N.

Identity
Molecular formulaC5H6BrClN2O2
Molecular weight241.47 g/mol
IUPAC name5-bromo-1-methylimidazole-2-carboxylic acid;hydrochloride
InChIKeyZXPSCQZCUHUELV-UHFFFAOYSA-N
SMILESCN1C(=CN=C1C(=O)O)Br.Cl

Computed by PubChem (NCBI)