cas: 1417567-41-9 — see every product listed under this CAS number, including other names
1-Bromo-3-chloro-5-(trifluoromethoxy)benzene, 96%, 96% (CAS 1417567-41-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HW8L-1g |
| cas | 1417567-41-9 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 10g | 285.20 Pln | |
| Chemat | 25g | 606.80 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
1-bromo-3-chloro-5-(trifluoromethoxy)benzene (CAS 1417567-41-9) is a chemical compound with the molecular formula C7H3BrClF3O and a molecular weight of 275.45 g/mol. IUPAC name: 1-bromo-3-chloro-5-(trifluoromethoxy)benzene. InChIKey: HGPFOMWNRNCDMI-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClF3O |
|---|---|
| Molecular weight | 275.45 g/mol |
| IUPAC name | 1-bromo-3-chloro-5-(trifluoromethoxy)benzene |
| InChIKey | HGPFOMWNRNCDMI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Br)OC(F)(F)F |
Computed by PubChem (NCBI)