cas: 1417567-41-9 — see every product listed under this CAS number, including other names
3-BROMO-5-CHLORO-1-(TRIFLUOROMETHOXY)BENZENE, 96% (CAS 1417567-41-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F470790-250MG |
| cas | 1417567-41-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 96.86 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 232.23 Pln | |
| Fluorochem | 10g | 362.39 Pln | |
| Fluorochem | 25g | 789.32 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
1-bromo-3-chloro-5-(trifluoromethoxy)benzene (CAS 1417567-41-9) is a chemical compound with the molecular formula C7H3BrClF3O and a molecular weight of 275.45 g/mol. IUPAC name: 1-bromo-3-chloro-5-(trifluoromethoxy)benzene. InChIKey: HGPFOMWNRNCDMI-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClF3O |
|---|---|
| Molecular weight | 275.45 g/mol |
| IUPAC name | 1-bromo-3-chloro-5-(trifluoromethoxy)benzene |
| InChIKey | HGPFOMWNRNCDMI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Br)OC(F)(F)F |
Computed by PubChem (NCBI)