1-Bromo-3-fluoro-5-nitrobenzene, 98%
cas: 7087-65-2 — see every product listed under this CAS number, including other names
1-Bromo-3-fluoro-5-nitrobenzene, 98% (CAS 7087-65-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A146070-1g |
| cas | 7087-65-2 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 192.38 Pln | |
| Ambeed | 25g | 348.12 Pln | |
| Ambeed | 100g | 1182.50 Pln | |
| Ambeed | 500g | 4514.44 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 136.64 Pln | |
| BLDpharm | 10g | 203.29 Pln | |
| BLDpharm | 25g | 369.89 Pln | |
| BLDpharm | 100g | 1269.58 Pln | |
| BLDpharm | 500g | 6051.23 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1-bromo-3-fluoro-5-nitrobenzene (CAS 7087-65-2) is a chemical compound with the molecular formula C6H3BrFNO2 and a molecular weight of 220.00 g/mol. IUPAC name: 1-bromo-3-fluoro-5-nitrobenzene. InChIKey: SWXVEPMSQBEVRH-UHFFFAOYSA-N.
| Molecular formula | C6H3BrFNO2 |
|---|---|
| Molecular weight | 220.00 g/mol |
| IUPAC name | 1-bromo-3-fluoro-5-nitrobenzene |
| InChIKey | SWXVEPMSQBEVRH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)
