1-Bromo-3-fluoronaphthalene, 95%
cas: 343-53-3 — see every product listed under this CAS number, including other names
1-Bromo-3-fluoronaphthalene, 95% (CAS 343-53-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A600633-100mg |
| cas | 343-53-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1071.25 Pln | |
| Ambeed | 250mg | 1649.75 Pln | |
| Ambeed | 1g | 3246.19 Pln | |
| BLDpharm | 100mg | 1147.40 Pln | |
| BLDpharm | 250mg | 1774.96 Pln | |
| BLDpharm | 1g | 3491.02 Pln | |
| Chemat | 100mg | 813.20 Pln | |
| Chemat | 250mg | 1307.60 Pln | |
| Chemat | 1g | 2598.80 Pln | |
| Fluorochem | 100mg | 1106.92 Pln | |
| Fluorochem | 250mg | 1695.25 Pln | |
| Fluorochem | 1g | 3319.68 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-bromo-3-fluoronaphthalene (CAS 343-53-3) is a chemical compound with the molecular formula C10H6BrF and a molecular weight of 225.06 g/mol. IUPAC name: 1-bromo-3-fluoronaphthalene. InChIKey: ANIVZBBYWMPEOI-UHFFFAOYSA-N.
| Molecular formula | C10H6BrF |
|---|---|
| Molecular weight | 225.06 g/mol |
| IUPAC name | 1-bromo-3-fluoronaphthalene |
| InChIKey | ANIVZBBYWMPEOI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2Br)F |
Computed by PubChem (NCBI)