CAS 13772-59-3 is the registry number for 3-Bromo-1-fluoronaphthalene. Offered by: Biosynth. Available pack sizes: 0,25g.
3-bromo-1-fluoronaphthalene (CAS 13772-59-3) is a chemical compound with the molecular formula C10H6BrF and a molecular weight of 225.06 g/mol. IUPAC name: 3-bromo-1-fluoronaphthalene. InChIKey: JYZPGEKVRNVONN-UHFFFAOYSA-N.
| Molecular formula | C10H6BrF |
|---|---|
| Molecular weight | 225.06 g/mol |
| IUPAC name | 3-bromo-1-fluoronaphthalene |
| InChIKey | JYZPGEKVRNVONN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2F)Br |
Computed by PubChem (NCBI)