cas: 312-20-9 — see every product listed under this CAS number, including other names
1-Bromo-4-((trifluoromethyl)sulfonyl)benzene 97% (CAS 312-20-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A174144-10g |
| cas | 312-20-9 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 3696.75 Pln | |
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 659.62 Pln | |
| Ambeed | 5g | 2333.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A174144 |
1-bromo-4-(trifluoromethylsulfonyl)benzene (CAS 312-20-9) is a chemical compound with the molecular formula C7H4BrF3O2S and a molecular weight of 289.07 g/mol. IUPAC name: 1-bromo-4-(trifluoromethylsulfonyl)benzene. InChIKey: BRNFLBCPGQCBQQ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3O2S |
|---|---|
| Molecular weight | 289.07 g/mol |
| IUPAC name | 1-bromo-4-(trifluoromethylsulfonyl)benzene |
| InChIKey | BRNFLBCPGQCBQQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)