cas: 312-20-9 — see every product listed under this CAS number, including other names
1-Bromo-4-((trifluoromethyl)sulfonyl)benzene, 97% (CAS 312-20-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F634082-250MG |
| cas | 312-20-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 310.33 Pln | |
| Fluorochem | 1g | 627.92 Pln | |
| Fluorochem | 5g | 2262.76 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-bromo-4-(trifluoromethylsulfonyl)benzene (CAS 312-20-9) is a chemical compound with the molecular formula C7H4BrF3O2S and a molecular weight of 289.07 g/mol. IUPAC name: 1-bromo-4-(trifluoromethylsulfonyl)benzene. InChIKey: BRNFLBCPGQCBQQ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3O2S |
|---|---|
| Molecular weight | 289.07 g/mol |
| IUPAC name | 1-bromo-4-(trifluoromethylsulfonyl)benzene |
| InChIKey | BRNFLBCPGQCBQQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)