cas: 55102-99-3 — see every product listed under this CAS number, including other names
1-Bromo-4-(4-fluorophenoxy)benzene 98% (CAS 55102-99-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A830742-250mg |
| cas | 55102-99-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 515.00 Pln | |
| Ambeed | 5g | 1788.81 Pln | |
| Ambeed | 10g | 3012.56 Pln | |
| Ambeed | 25g | 5321.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A830742 |
1-bromo-4-(4-fluorophenoxy)benzene (CAS 55102-99-3) is a chemical compound with the molecular formula C12H8BrFO and a molecular weight of 267.09 g/mol. IUPAC name: 1-bromo-4-(4-fluorophenoxy)benzene. InChIKey: QAOAGSVWMAMCGQ-UHFFFAOYSA-N.
| Molecular formula | C12H8BrFO |
|---|---|
| Molecular weight | 267.09 g/mol |
| IUPAC name | 1-bromo-4-(4-fluorophenoxy)benzene |
| InChIKey | QAOAGSVWMAMCGQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=CC=C(C=C2)Br)F |
Computed by PubChem (NCBI)