cas: 55102-99-3 — see every product listed under this CAS number, including other names
1-Bromo-4-(4-fluorophenoxy)benzene, 95% (CAS 55102-99-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F630609-250MG |
| cas | 55102-99-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 508.17 Pln | |
| Fluorochem | 1g | 1034.03 Pln | |
| Fluorochem | 5g | 3814.30 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-bromo-4-(4-fluorophenoxy)benzene (CAS 55102-99-3) is a chemical compound with the molecular formula C12H8BrFO and a molecular weight of 267.09 g/mol. IUPAC name: 1-bromo-4-(4-fluorophenoxy)benzene. InChIKey: QAOAGSVWMAMCGQ-UHFFFAOYSA-N.
| Molecular formula | C12H8BrFO |
|---|---|
| Molecular weight | 267.09 g/mol |
| IUPAC name | 1-bromo-4-(4-fluorophenoxy)benzene |
| InChIKey | QAOAGSVWMAMCGQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=CC=C(C=C2)Br)F |
Computed by PubChem (NCBI)