cas: 26732-20-7 — see every product listed under this CAS number, including other names
1-Bromo-4-(ethylsulfonyl)benzene 98% (CAS 26732-20-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A211481-100mg |
| cas | 26732-20-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1877.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A211481 |
1-bromo-4-ethylsulfonylbenzene (CAS 26732-20-7) is a chemical compound with the molecular formula C8H9BrO2S and a molecular weight of 249.13 g/mol. IUPAC name: 1-bromo-4-ethylsulfonylbenzene. InChIKey: UGLVDQBMOMYGJF-UHFFFAOYSA-N.
| Molecular formula | C8H9BrO2S |
|---|---|
| Molecular weight | 249.13 g/mol |
| IUPAC name | 1-bromo-4-ethylsulfonylbenzene |
| InChIKey | UGLVDQBMOMYGJF-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)