cas: 344-65-0 — see every product listed under this CAS number, including other names
1-Bromo-4-chloro-2-(trifluoromethyl)benzene, 98%, 98% (CAS 344-65-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1kg, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114GPF-10g |
| cas | 344-65-0 |
| size | 10g |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 83.60 Pln | |
| Chemat | 1kg | 1091.60 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 100g | 150.80 Pln | |
| Chemat | 500g | 585.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-4-chloro-2-(trifluoromethyl)benzene (CAS 344-65-0) is a chemical compound with the molecular formula C7H3BrClF3 and a molecular weight of 259.45 g/mol. IUPAC name: 1-bromo-4-chloro-2-(trifluoromethyl)benzene. InChIKey: OSTIALFVJOFNPP-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClF3 |
|---|---|
| Molecular weight | 259.45 g/mol |
| IUPAC name | 1-bromo-4-chloro-2-(trifluoromethyl)benzene |
| InChIKey | OSTIALFVJOFNPP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(F)(F)F)Br |
Computed by PubChem (NCBI)