cas: 344-65-0 — see every product listed under this CAS number, including other names
1-Bromo-4-chloro-2-(trifluoromethyl)benzene 98+% (CAS 344-65-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1485744-25g |
| cas | 344-65-0 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 164.56 Pln | |
| Ambeed | 100g | 209.06 Pln | |
| Ambeed | 500g | 715.25 Pln | |
| Ambeed | 1000g | 1221.44 Pln |
| purity | 98+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1485744 |
1-bromo-4-chloro-2-(trifluoromethyl)benzene (CAS 344-65-0) is a chemical compound with the molecular formula C7H3BrClF3 and a molecular weight of 259.45 g/mol. IUPAC name: 1-bromo-4-chloro-2-(trifluoromethyl)benzene. InChIKey: OSTIALFVJOFNPP-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClF3 |
|---|---|
| Molecular weight | 259.45 g/mol |
| IUPAC name | 1-bromo-4-chloro-2-(trifluoromethyl)benzene |
| InChIKey | OSTIALFVJOFNPP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(F)(F)F)Br |
Computed by PubChem (NCBI)