cas: 1187984-18-4 — see every product listed under this CAS number, including other names
1-Bromo-4-iodo-2-(trifluoromethoxy)benzene 97% (CAS 1187984-18-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A119668-10g |
| cas | 1187984-18-4 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 5944.00 Pln | |
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 1093.50 Pln | |
| Ambeed | 5g | 3741.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A119668 |
1-bromo-4-iodo-2-(trifluoromethoxy)benzene (CAS 1187984-18-4) is a chemical compound with the molecular formula C7H3BrF3IO and a molecular weight of 366.90 g/mol. IUPAC name: 1-bromo-4-iodo-2-(trifluoromethoxy)benzene. InChIKey: RZYCOYDGYHAOSE-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3IO |
|---|---|
| Molecular weight | 366.90 g/mol |
| IUPAC name | 1-bromo-4-iodo-2-(trifluoromethoxy)benzene |
| InChIKey | RZYCOYDGYHAOSE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)OC(F)(F)F)Br |
Computed by PubChem (NCBI)