cas: 1187984-18-4 — see every product listed under this CAS number, including other names
1-Bromo-4-iodo-2-(trifluoromethoxy)benzene, 97%, 97% (CAS 1187984-18-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DDLL-10g |
| cas | 1187984-18-4 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 2070.80 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 467.60 Pln | |
| Chemat | 5g | 1264.40 Pln | |
| Chemat | 25g | 4029.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-bromo-4-iodo-2-(trifluoromethoxy)benzene (CAS 1187984-18-4) is a chemical compound with the molecular formula C7H3BrF3IO and a molecular weight of 366.90 g/mol. IUPAC name: 1-bromo-4-iodo-2-(trifluoromethoxy)benzene. InChIKey: RZYCOYDGYHAOSE-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3IO |
|---|---|
| Molecular weight | 366.90 g/mol |
| IUPAC name | 1-bromo-4-iodo-2-(trifluoromethoxy)benzene |
| InChIKey | RZYCOYDGYHAOSE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)OC(F)(F)F)Br |
Computed by PubChem (NCBI)