cas: 1160573-63-6 — see every product listed under this CAS number, including other names
1-Bromo-4-iodo-5-methyl-2-nitrobenzene, 97%, 97% (CAS 1160573-63-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12E6PT-100mg |
| cas | 1160573-63-6 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 213.20 Pln | |
| Chemat | 5g | 654.80 Pln | |
| Chemat | 10g | 1168.40 Pln | |
| Chemat | 25g | 2622.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-bromo-4-iodo-5-methyl-2-nitrobenzene (CAS 1160573-63-6) is a chemical compound with the molecular formula C7H5BrINO2 and a molecular weight of 341.93 g/mol. IUPAC name: 1-bromo-4-iodo-5-methyl-2-nitrobenzene. InChIKey: OORCPJADBMDQNC-UHFFFAOYSA-N.
| Molecular formula | C7H5BrINO2 |
|---|---|
| Molecular weight | 341.93 g/mol |
| IUPAC name | 1-bromo-4-iodo-5-methyl-2-nitrobenzene |
| InChIKey | OORCPJADBMDQNC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1I)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)