CAS 214279-41-1 appears in our catalog under these names: 4-(Bromomethyl)-2-iodo-1-nitrobenzene, Alpha-bromo-3-iodo-4-nitrotoluene, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 1000mg, 250mg, 2000mg, 5000mg, 100mg, 1g.
4-(bromomethyl)-2-iodo-1-nitrobenzene (CAS 214279-41-1) is a chemical compound with the molecular formula C7H5BrINO2 and a molecular weight of 341.93 g/mol. IUPAC name: 4-(bromomethyl)-2-iodo-1-nitrobenzene. InChIKey: SETQWQQIMOUZRS-UHFFFAOYSA-N.
| Molecular formula | C7H5BrINO2 |
|---|---|
| Molecular weight | 341.93 g/mol |
| IUPAC name | 4-(bromomethyl)-2-iodo-1-nitrobenzene |
| InChIKey | SETQWQQIMOUZRS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CBr)I)[N+](=O)[O-] |
Computed by PubChem (NCBI)