cas: 68494-29-1 — see every product listed under this CAS number, including other names
1-Bromo-4-trityl-benzene, 97%, 97% (CAS 68494-29-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FH04-250mg |
| cas | 68494-29-1 |
| size | 250mg |
| availability | 9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 285.20 Pln | |
| Chemat | 1g | 515.60 Pln | |
| Chemat | 5g | 1202.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-bromo-4-tritylbenzene (CAS 68494-29-1) is a chemical compound with the molecular formula C25H19Br and a molecular weight of 399.3 g/mol. IUPAC name: 1-bromo-4-tritylbenzene. InChIKey: FIJIRZKOKTVVOZ-UHFFFAOYSA-N.
| Molecular formula | C25H19Br |
|---|---|
| Molecular weight | 399.3 g/mol |
| IUPAC name | 1-bromo-4-tritylbenzene |
| InChIKey | FIJIRZKOKTVVOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)