CAS 68494-29-1 appears in our catalog under these names: 1-Bromo-4-trityl-benzene, 95%, 1-BROMO-4-TRITYL-BENZENE, 97%, 1-Bromo-4-trityl-benzene, 97%, 97%, ((4-Bromophenyl)methanetriyl)tribenzene 97%. Offered by: Combi-blocks, Fluorochem, Chemat, Ambeed. Available pack sizes: 10g, 5g, 1g, 250mg.
1-bromo-4-tritylbenzene (CAS 68494-29-1) is a chemical compound with the molecular formula C25H19Br and a molecular weight of 399.3 g/mol. IUPAC name: 1-bromo-4-tritylbenzene. InChIKey: FIJIRZKOKTVVOZ-UHFFFAOYSA-N.
| Molecular formula | C25H19Br |
|---|---|
| Molecular weight | 399.3 g/mol |
| IUPAC name | 1-bromo-4-tritylbenzene |
| InChIKey | FIJIRZKOKTVVOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)