1-Bromodibenzo[b,d]thiophene, 99%, 99%
cas: 65642-94-6 — see every product listed under this CAS number, including other names
1-Bromodibenzo[b,d]thiophene, 99%, 99% (CAS 65642-94-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117Q91-100mg |
| cas | 65642-94-6 |
| size | 100mg |
| availability | 200g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 544.40 Pln | |
| Chemat | 10g | 890.00 Pln | |
| Chemat | 25g | 1782.80 Pln | |
| Chemat | 50g | 2819.60 Pln | |
| Chemat | 100g | 4542.80 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
1-bromodibenzothiophene (CAS 65642-94-6) is a chemical compound with the molecular formula C12H7BrS and a molecular weight of 263.15 g/mol. IUPAC name: 1-bromodibenzothiophene. InChIKey: JESBGFNZNSEZMR-UHFFFAOYSA-N.
| Molecular formula | C12H7BrS |
|---|---|
| Molecular weight | 263.15 g/mol |
| IUPAC name | 1-bromodibenzothiophene |
| InChIKey | JESBGFNZNSEZMR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(S2)C=CC=C3Br |
Computed by PubChem (NCBI)