CAS 22439-61-8 appears in our catalog under these names: 2-Bromodibenzo(b,d)thiophene, 2–Bromodibenzothiophene, 2-Bromodibenzothiophene, 98% , 2-Bromodibenzothiophene, >95.0%(GC), 2-Bromodibenzo[b,d]thiophene 98%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 10g, 25g, 5g, 100g, 500g, 1000g, 1g, 1kg.
2-bromodibenzothiophene (CAS 22439-61-8) is a chemical compound with the molecular formula C12H7BrS and a molecular weight of 263.15 g/mol. IUPAC name: 2-bromodibenzothiophene. InChIKey: IJICRIUYZZESMW-UHFFFAOYSA-N.
| Molecular formula | C12H7BrS |
|---|---|
| Molecular weight | 263.15 g/mol |
| IUPAC name | 2-bromodibenzothiophene |
| InChIKey | IJICRIUYZZESMW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(S2)C=CC(=C3)Br |
Computed by PubChem (NCBI)