cas: 1881295-19-7 — see every product listed under this CAS number, including other names
1-Butoxy-4-chloro-2,3-difluorobenzene, ≥95%, ≥95% (CAS 1881295-19-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I39L-1g |
| cas | 1881295-19-7 |
| size | 1g |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2526.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
1-butoxy-4-chloro-2,3-difluorobenzene (CAS 1881295-19-7) is a chemical compound with the molecular formula C10H11ClF2O and a molecular weight of 220.64 g/mol. IUPAC name: 1-butoxy-4-chloro-2,3-difluorobenzene. InChIKey: RWCFUSMLQCBYLW-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF2O |
|---|---|
| Molecular weight | 220.64 g/mol |
| IUPAC name | 1-butoxy-4-chloro-2,3-difluorobenzene |
| InChIKey | RWCFUSMLQCBYLW-UHFFFAOYSA-N |
| SMILES | CCCCOC1=C(C(=C(C=C1)Cl)F)F |
Computed by PubChem (NCBI)