Products 2734776-37-3
CAS 2734776-37-3 is the registry number for 1-(4-Chloro-2,3-difluorophenyl)butan-1-ol, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-(4-chloro-2,3-difluorophenyl)butan-1-ol (CAS 2734776-37-3) is a chemical compound with the molecular formula C10H11ClF2O and a molecular weight of 220.64 g/mol. IUPAC name: 1-(4-chloro-2,3-difluorophenyl)butan-1-ol. InChIKey: KIJVBHRWKDNEEC-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF2O |
|---|---|
| Molecular weight | 220.64 g/mol |
| IUPAC name | 1-(4-chloro-2,3-difluorophenyl)butan-1-ol |
| InChIKey | KIJVBHRWKDNEEC-UHFFFAOYSA-N |
| SMILES | CCCC(C1=C(C(=C(C=C1)Cl)F)F)O |
Computed by PubChem (NCBI)