cas: 874299-07-7 — see every product listed under this CAS number, including other names
1-Butyl-3-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)urea, 98% (CAS 874299-07-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F213336-250MG |
| cas | 874299-07-7 |
| size | 250mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 539.41 Pln | |
| Fluorochem | 5g | 1856.66 Pln | |
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 403.75 Pln | |
| Ambeed | 5g | 1371.62 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 328.40 Pln | |
| Chemat | 5g | 1110.80 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
1-butyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea (CAS 874299-07-7) is a chemical compound with the molecular formula C17H27BN2O3 and a molecular weight of 318.2 g/mol. IUPAC name: 1-butyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea. InChIKey: DYBDTMCEAHKZHI-UHFFFAOYSA-N.
| Molecular formula | C17H27BN2O3 |
|---|---|
| Molecular weight | 318.2 g/mol |
| IUPAC name | 1-butyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
| InChIKey | DYBDTMCEAHKZHI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)NC(=O)NCCCC |
Computed by PubChem (NCBI)