cas: 700370-07-6 — see every product listed under this CAS number, including other names
1-CarboxyMethyl-3-MethyliMidazoliuM chloride, 99%, 99% (CAS 700370-07-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1175OH-5g |
| cas | 700370-07-6 |
| size | 5g |
| availability | 1500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 107.60 Pln | |
| Chemat | 100g | 237.20 Pln | |
| Chemat | 500g | 1017.60 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)acetic acid chloride (CAS 700370-07-6) is a chemical compound with the molecular formula C6H11ClN2O2 and a molecular weight of 178.62 g/mol. IUPAC name: 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)acetic acid chloride. InChIKey: WBOALDSUMSMSCQ-UHFFFAOYSA-N.
| Molecular formula | C6H11ClN2O2 |
|---|---|
| Molecular weight | 178.62 g/mol |
| IUPAC name | 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)acetic acid chloride |
| InChIKey | WBOALDSUMSMSCQ-UHFFFAOYSA-N |
| SMILES | CN1C[NH+](C=C1)CC(=O)O.[Cl-] |
Computed by PubChem (NCBI)