cas: 700370-07-6 — see every product listed under this CAS number, including other names
3-(Carboxymethyl)-1-methyl-1H-imidazol-3-ium Chloride, >98.0%(HPLC)(T) (CAS 700370-07-6) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C3870-25G |
| cas | 700370-07-6 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 270.78 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)acetic acid chloride (CAS 700370-07-6) is a chemical compound with the molecular formula C6H11ClN2O2 and a molecular weight of 178.62 g/mol. IUPAC name: 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)acetic acid chloride. InChIKey: WBOALDSUMSMSCQ-UHFFFAOYSA-N.
| Molecular formula | C6H11ClN2O2 |
|---|---|
| Molecular weight | 178.62 g/mol |
| IUPAC name | 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)acetic acid chloride |
| InChIKey | WBOALDSUMSMSCQ-UHFFFAOYSA-N |
| SMILES | CN1C[NH+](C=C1)CC(=O)O.[Cl-] |
Computed by PubChem (NCBI)