cas: 1385696-68-3 — see every product listed under this CAS number, including other names
1-Cbz-1,8-diazaspiro[4.5]decane hydrochloride, 98%, 98% (CAS 1385696-68-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1129R5-100mg |
| cas | 1385696-68-3 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 635.60 Pln | |
| Chemat | 1g | 1216.40 Pln | |
| Chemat | 5g | 3491.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Benzyl 1,8-diazaspiro[4.5]decane-1-carboxylate;hydrochloride (CAS 1385696-68-3) is a chemical compound with the molecular formula C16H23ClN2O2 and a molecular weight of 310.82 g/mol. IUPAC name: benzyl 1,8-diazaspiro[4.5]decane-1-carboxylate;hydrochloride. InChIKey: FIQZCNCKMGHANL-UHFFFAOYSA-N.
| Molecular formula | C16H23ClN2O2 |
|---|---|
| Molecular weight | 310.82 g/mol |
| IUPAC name | benzyl 1,8-diazaspiro[4.5]decane-1-carboxylate;hydrochloride |
| InChIKey | FIQZCNCKMGHANL-UHFFFAOYSA-N |
| SMILES | C1CC2(CCNCC2)N(C1)C(=O)OCC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)