cas: 1385696-68-3 — see every product listed under this CAS number, including other names
Benzyl 1,8-diazaspiro[4.5]decane-1-carboxylate hydrochloride, 98% (CAS 1385696-68-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F097247-100MG |
| cas | 1385696-68-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 466.52 Pln | |
| Fluorochem | 250mg | 570.65 Pln | |
| Fluorochem | 500mg | 721.64 Pln | |
| Fluorochem | 1g | 737.26 Pln | |
| Fluorochem | 5g | 778.91 Pln | |
| Fluorochem | 10g | 909.07 Pln | |
| Fluorochem | 25g | 2189.87 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Benzyl 1,8-diazaspiro[4.5]decane-1-carboxylate;hydrochloride (CAS 1385696-68-3) is a chemical compound with the molecular formula C16H23ClN2O2 and a molecular weight of 310.82 g/mol. IUPAC name: benzyl 1,8-diazaspiro[4.5]decane-1-carboxylate;hydrochloride. InChIKey: FIQZCNCKMGHANL-UHFFFAOYSA-N.
| Molecular formula | C16H23ClN2O2 |
|---|---|
| Molecular weight | 310.82 g/mol |
| IUPAC name | benzyl 1,8-diazaspiro[4.5]decane-1-carboxylate;hydrochloride |
| InChIKey | FIQZCNCKMGHANL-UHFFFAOYSA-N |
| SMILES | C1CC2(CCNCC2)N(C1)C(=O)OCC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)