cas: 405057-75-2 — see every product listed under this CAS number, including other names
1-Cbz-4-Methylaminopieridine, 97% (CAS 405057-75-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211961-250MG |
| cas | 405057-75-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 112.48 Pln | |
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 320.74 Pln | |
| Fluorochem | 10g | 591.48 Pln | |
| Fluorochem | 25g | 1388.07 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Benzyl 4-(methylamino)piperidine-1-carboxylate (CAS 405057-75-2) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: benzyl 4-(methylamino)piperidine-1-carboxylate. InChIKey: UKMMXAXGJCWGTF-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | benzyl 4-(methylamino)piperidine-1-carboxylate |
| InChIKey | UKMMXAXGJCWGTF-UHFFFAOYSA-N |
| SMILES | CNC1CCN(CC1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)