cas: 405057-75-2 — see every product listed under this CAS number, including other names
1-Cbz-4-Methylaminopieridine, 98%, 98% (CAS 405057-75-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I8XT-25g |
| cas | 405057-75-2 |
| size | 25g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 1043.60 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 270.80 Pln | |
| Chemat | 10g | 477.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Benzyl 4-(methylamino)piperidine-1-carboxylate (CAS 405057-75-2) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: benzyl 4-(methylamino)piperidine-1-carboxylate. InChIKey: UKMMXAXGJCWGTF-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | benzyl 4-(methylamino)piperidine-1-carboxylate |
| InChIKey | UKMMXAXGJCWGTF-UHFFFAOYSA-N |
| SMILES | CNC1CCN(CC1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)