cas: 277328-34-4 — see every product listed under this CAS number, including other names
1-Cbz-Amino-2-methylaminoethane HCl 97% (CAS 277328-34-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A215398-100mg |
| cas | 277328-34-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 459.38 Pln | |
| Ambeed | 1g | 776.44 Pln | |
| Ambeed | 5g | 2311.69 Pln | |
| Ambeed | 10g | 3808.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A215398 |
Benzyl N-[2-(methylamino)ethyl]carbamate;hydrochloride (CAS 277328-34-4) is a chemical compound with the molecular formula C11H17ClN2O2 and a molecular weight of 244.72 g/mol. IUPAC name: benzyl N-[2-(methylamino)ethyl]carbamate;hydrochloride. InChIKey: OCADBAIAKGMWBO-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN2O2 |
|---|---|
| Molecular weight | 244.72 g/mol |
| IUPAC name | benzyl N-[2-(methylamino)ethyl]carbamate;hydrochloride |
| InChIKey | OCADBAIAKGMWBO-UHFFFAOYSA-N |
| SMILES | CNCCNC(=O)OCC1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)