CAS 1881329-03-8 is the registry number for 3-amino-N,N-diethyl-5-hydroxybenzamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-amino-N,N-diethyl-5-hydroxybenzamide;hydrochloride (CAS 1881329-03-8) is a chemical compound with the molecular formula C11H17ClN2O2 and a molecular weight of 244.72 g/mol. IUPAC name: 3-amino-N,N-diethyl-5-hydroxybenzamide;hydrochloride. InChIKey: IGUKPGRALUZAKS-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN2O2 |
|---|---|
| Molecular weight | 244.72 g/mol |
| IUPAC name | 3-amino-N,N-diethyl-5-hydroxybenzamide;hydrochloride |
| InChIKey | IGUKPGRALUZAKS-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC(=CC(=C1)O)N.Cl |
Computed by PubChem (NCBI)