cas: 261763-01-3 — see every product listed under this CAS number, including other names
1-Chloro-2-fluoro-3-methoxy-5-(trifluoromethyl)benzene, 98%, 98% (CAS 261763-01-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113S2S-100mg |
| cas | 261763-01-3 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 174.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-chloro-2-fluoro-3-methoxy-5-(trifluoromethyl)benzene (CAS 261763-01-3) is a chemical compound with the molecular formula C8H5ClF4O and a molecular weight of 228.57 g/mol. IUPAC name: 1-chloro-2-fluoro-3-methoxy-5-(trifluoromethyl)benzene. InChIKey: HROFCMRAPMYLRR-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF4O |
|---|---|
| Molecular weight | 228.57 g/mol |
| IUPAC name | 1-chloro-2-fluoro-3-methoxy-5-(trifluoromethyl)benzene |
| InChIKey | HROFCMRAPMYLRR-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C(F)(F)F)Cl)F |
Computed by PubChem (NCBI)